| Identification | |
| Name: | a-D-Glucopyranoside, phenyl |
| Synonyms: | Glucopyranoside,phenyl, a-D- (8CI); NSC 226967; Phenyl a-D-glucopyranoside; Phenyl a-D-glucoside |
| CAS: | 4630-62-0 |
| Molecular Formula: | C12H16 O6 |
| Molecular Weight: | 256.2518 |
| InChI: | InChI=1/C12H16O6/c13-6-8-9(14)10(15)11(16)12(18-8)17-7-4-2-1-3-5-7/h1-5,8-16H,6H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 172 °C |
| Density: | 1.451 g/cm3 |
| Refractive index: | 180 ° (C=1, H2O) |
| Specification: | White Crystalline Solid usageEng:Inhibits sucrose transport into plant cells Safety Statements:26-27-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Storage Temperature: | −20°C |
| Usage: | Inhibits sucrose transport into plant cells |
| Safety Data | |
 |
|
