| Identification | |
| Name: | 3-Thiophenecarbonitrile,2-amino- |
| Synonyms: | 2-Amino-3-cyanothiophene;2-Aminothiophene-3-carbonitrile |
| CAS: | 4651-82-5 |
| Molecular Formula: | C5H4N2S |
| Molecular Weight: | 124.16 |
| InChI: | InChI=1/C5H4N2S/c6-3-4-1-2-8-5(4)7/h1-2H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Flash Point: | 145.8°C |
| Boiling Point: | 317.5°Cat760mmHg |
| Density: | 1.33g/cm3 |
| Refractive index: | 1.627 |
| Appearance: | white to light yellow crystal powder |
| Specification: |
3-Thiophenecarbonitrile,2-amino- , its cas register number is 4651-82-5. It also can be called 2-Amino-3-thiophenecarbonitrile ; 2-Aminothiophen-3-carbonitril ; 2-Amino-3-Cyanothiophene . 3-Thiophenecarbonitrile,2-amino- (CAS NO.4651-82-5) is harmful by inhalation, in contact with skin and if swallowed. And it's also irritating to eyes, respiratory system and skin. |
| Flash Point: | 145.8°C |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
