| Identification | |
| Name: | 1-Butanol, 4-bromo-,1-acetate |
| Synonyms: | 1-Butanol,4-bromo-, acetate (6CI,7CI,8CI,9CI); 1-Acetoxy-4-bromobutane;4-Acetoxy-1-bromobutane; 4-Acetoxybutyl bromide; 4-Bromo-1-acetoxybutane;4-Bromo-1-butanol acetate; 4-Bromo-1-butyl acetate; 4-Bromobutyl acetate;Acetic acid 4-bromobutyl ester; NSC 33919 |
| CAS: | 4753-59-7 |
| EINECS: | 225-277-7 |
| Molecular Formula: | C6H11 Br O2 |
| Molecular Weight: | 195.05 |
| InChI: | InChI=1/C6H11BrO2/c1-6(8)9-5-3-2-4-7/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.348 |
| Refractive index: | 1.459-1.461 |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Specification: |
1-Butanol, 4-bromo-,1-acetate , with CAS number of 4753-59-7, can be called 4-bromo-1-butanoacetate ; 4-acetoxy-1-bromobutane ; 4-bromobutyl acetate ; 4-bromo-n-butyl acetate ; 1-acetoxy-4-bromobutane ; acetic acid 4-bromobutyl ester ; 4-bromo-1-butanol acetate ; 4-bromobutyl acetate, 98+% . It is a clear colourless to slightly yellow liquid. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
