| Identification | |
| Name: | 1-Butanol, 4-chloro-,1-acetate |
| CAS: | 6962-92-1 |
| EINECS: | 230-158-8 |
| Molecular Formula: | C6H11ClO2 |
| Molecular Weight: | 150.6 |
| InChI: | InChI=1/C6H11ClO2/c1-6(8)9-5-3-2-4-7/h2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3272 |
| Density: | 1.072 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.433-1.435 |
| Water Solubility: | inmisceable |
| Solubility: | inmisceable |
| Appearance: | Colorless liquid. |
| Specification: |
4-Chlorobutyl acetate (CAS NO.6962-92-1), its Synonyms are 4-Chlorobutyl acetate,98% ; 1-Acetoxy-4-Chlorobutane ; 1-Chloro-4-acetoxybutane ; 4-Chlorbut-1-ylacetat ; 4-chloro-1-butanoacetate ; 4-Chloro-N-butyl acetate ; delta-Chlorobutyl acetate ; delta-chlorobutylacetate . It is clear colorless liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
