| Identification | |
| Name: | Ethyl oxalyl monochloride |
| Synonyms: | Ethyl chloroglyoxylate~Oxalic acid monoethyl ester chloride; ethyl chlorooxoacetate; ethyl (chloroformyl)formate; mono-Ethyl oxalyl chloride; ETHOXALYL CHLORIDE; ETCOX; ETHYL OXALYL CHLORIDE; ETHYL CHLOROGLYOXALATE; ETHYL CHLOROGLYOXYLATE |
| CAS: | 4755-77-5 |
| EINECS: | 225-285-0 |
| Molecular Formula: | C4H5ClO3 |
| Molecular Weight: | 136.53 |
| InChI: | InChI=1/C4H5ClO3/c1-2-8-4(7)3(5)6/h2H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2920 |
| Density: | 1.222 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.416 |
| Solubility: | Slightly soluble |
| Appearance: | Clear light yellow liquid. |
| Specification: |
Acetic acid, 2-chloro-2-oxo-, ethyl ester , its CAS NO. is 4755-77-5, the synonyms are EINECS 225-285-0 ; Ethoxalyl chloride ; Ethyl 2-chloro-2-oxoacetate ; Ethyl chloroglyoxylate ; Ethyl oxalyl chloride ; Glyoxylic acid, chloro-, ethyl ester ; Monoethyl oxaloyl chloride ; NSC 80644 ; Oxalic acid monoethyl ester chloride ; Oxalyl chloride, ethyl ester ; Acetic acid, chlorooxo-, ethyl ester . |
| Packinggroup: | II |
| HS Code: | 29171990 |
| Storage Temperature: | Flammables area |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
