| Identification | |
| Name: | Oxalyl chloride |
| Synonyms: | Oxalic dichloride; oxalicdichloride; Oxaloyl chloride; oxaloylchloride; OXALYL CHLORIDE; OXALYL DICHLORIDE; OXALIC ACID CHLORIDE; OXALIC ACID DICHLORIDE ; Ethanedioyl chloride |
| CAS: | 79-37-8 |
| EINECS: | 201-200-2 |
| Molecular Formula: | C2Cl2O2 |
| Molecular Weight: | 126.93 |
| InChI: | InChI=1/C2Cl2O2/c3-1(5)2(4)6 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2922 |
| Density: | 1.335 |
| Stability: | Stable. Incompatible with bases, alcohols, steel, oxidizing agents, alkali metals. Moisture sensitive. Reacts violently with water, liberating toxic gas. |
| Refractive index: | 1.429 |
| Water Solubility: | reacts |
| Solubility: | reacts with water |
| Appearance: | colourless liquid with a pungent odour |
| Specification: |
?Oxalyl chloride (CAS NO.79-37-8) is also named as 4-02-00-01853 (Beilstein Handbook Reference) ; BRN 1361988 ; Ethanedioyl chloride ; Oxalic acid chloride ; Oxalic acid dichloride ; Oxalic dichloride ; Oxaloyl chloride ; Oxalyl dichloride?; |
| Packinggroup: | II |
| HS Code: | 29171990 |
| Storage Temperature: | Store Cold |
| Sensitive: | Moisture Sensitive |
| Usage: | Reagent used in organic synthesis. |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
