| Identification | |
| Name: | 2H-1-Benzopyran-2-one,6-hydroxy-7-methoxy-4-phenyl- |
| Synonyms: | Coumarin,6-hydroxy-7-methoxy-4-phenyl- (7CI,8CI); 6-Hydroxy-7-methoxy-4-phenylcoumarin;Dalbergin |
| CAS: | 482-83-7 |
| Molecular Formula: | C16H12 O4 |
| Molecular Weight: | 268.26 |
| InChI: | InChI=1/C16H12O4/c1-19-15-9-14-12(7-13(15)17)11(8-16(18)20-14)10-5-3-2-4-6-10/h2-9,17H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 210°C |
| Flash Point: | 187.5°C |
| Boiling Point: | 489°Cat760mmHg |
| Density: | 1.329g/cm3 |
| Refractive index: | 1.641 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 187.5°C |
| Safety Data | |
 |
|
