Identification |
Name: | (+/-)-METHAMPHETAMINE |
Synonyms: | AURORA KA-7724;DL-METHAMPHETAMINE;(+/-)-METHAMPHETAMINE;d-Deoxyephedrine solution, DL-1-Phenyl-2(methylamino)propane solution;DL-Methamphetamine solution;rac-(R*)-N-Methyl-1-phenyl-2-propanamine;methyl-(1-methyl-2-phenyl-ethyl)amine;N-methyl-1-phenyl-propan-2-amine |
CAS: | 4846-07-5 |
EINECS: | 225-433-4 |
Molecular Formula: | C10H15N |
Molecular Weight: | 149.23 |
InChI: | InChI=1/C10H15N/c1-9(11-2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 1230 3/PG 2 |
Melting Point: | 170-2 deg C |
Flash Point: | 11 °C |
Boiling Point: | 212 DEG C AT 760 MM HG |
Density: | 0.907 g/cm3 |
Solubility: | 0.5 g/ml of water SOL IN ETHANOL, DIETHYL ETHER Miscible with chloroform |
Flash Point: | 11 °C |
Storage Temperature: | 2-8°C |
Color: | Clear, colorless liquid |
Safety Data |
|
 |