| Identification | |
| Name: | l-METHAMPHETAMINE HYDROCHLORIDE |
| Synonyms: | (R)-N,alpha-dimethylphenethylamine hydrochloride;Benzeneethanamine, N,a-dimethyl-, hydrochloride, (aR)- (9CI);Benzeneethanamine, N,a-dimethyl-, hydrochloride, (R)-;l-Methamphetamine hydrochloride;Einecs 212-552-1;L-Desoxyephedrine hydrochloride;L-Methamphetamine HCl;L-N-Methyl-beta-phenylisopropylamine hydrochloride |
| CAS: | 826-10-8 |
| EINECS: | 212-552-1 |
| Molecular Formula: | C10H15N•ClH |
| Molecular Weight: | 185.72 |
| InChI: | InChI=1/C10H15N.ClH/c1-9(11-2)8-10-6-4-3-5-7-10;/h3-7,9,11H,8H2,1-2H3;1H/t9-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 170-2 deg C |
| Boiling Point: | 212 DEG C AT 760 MM HG |
| Solubility: | 0.5 g/ml of water SOL IN ETHANOL, DIETHYL ETHER Miscible with chloroform |
| Specification: |
l-Methamphetamine hydrochloride with cas registry number of 826-10-8 is also known as N,alpha-Dimethylphenethylamine hydrochloride, (-)- ; l-Desoxyephedrine hydrochloride ; l-Methamphetamine HCl ; l-N-Methyl-beta-phenylisopropylamine hydrochloride ; (R)-N,alpha-Dimethylphenethylamine hydrochloride ; Phenethylamine, N,alpha-dimethyl-, hydrochloride, (-)- . |
| Color: | Clear, colorless liquid |
| Safety Data | |
 |
|
