| Identification |
| Name: | L(-)-Phenylephrine hydrochloride |
| Synonyms: | L-Phenylephrine hydrochloride; (R)-3-Hydroxy-alpha-(methylaminomethyl)benzyl alcohol hydrochloride; Phenylephrine HCL |
| CAS: | 61-76-7 |
| EINECS: | 200-517-3 |
| Molecular Formula: | C9H13NO2?HCl |
| Molecular Weight: | 203.67 |
| InChI: | InChI=1/C9H13NO2.ClH/c1-10-6-9(12)7-3-2-4-8(11)5-7;/h2-5,9-12H,6H2,1H3;1H/t9-;/m0./s1 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3249 |
| Alpha: | -47 o (C=2, H2O) |
| Solubility: | >=10 g/100 mL at 21 oC |
| Appearance: | white to almost white crystalline powder |
| Packinggroup: | III |
| Biological Activity: | α 1 -adrenoceptor agonist; pK i values are 5.86, 4.87 and 4.70 for α 1D , α 1B and α 1A receptors respectively. |
| Storage Temperature: | Desiccate at RT |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
