| Identification | |
| Name: | 1,6-BISMALEIMIDOHEXANE |
| CAS: | 4856-87-5 |
| EINECS: | 225-449-1 |
| Molecular Formula: | C14H16N2O4 |
| Molecular Weight: | 276.29 |
| InChI: | InChI=1/C14H16N2O4/c17-11-5-6-12(18)15(11)9-3-1-2-4-10-16-13(19)7-8-14(16)20/h5-8H,1-4,9-10H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 144 °C |
| Flash Point: | 218.1°C |
| Boiling Point: | 465.7°C at 760 mmHg |
| Density: | 1.304g/cm3 |
| Refractive index: | 1.571 |
| Flash Point: | 218.1°C |
| Storage Temperature: | 0-6°C |
| Usage: | A sulfhydryl reactive homobifunctional crosslinking reagent. Under mild conditions, will permit irreversible cross-linking of sulfhydral containing compounds at a pH range of 6.5 to 7.5. Spacer Arm: 16.1 Angstroms |
| Safety Data | |
 |
|
