| Identification | |
| Name: | scyllo-Inositol |
| Synonyms: | Inositol,scyllo- (8CI); Scyllitol (6CI,7CI); AZD 103; Cocositol; Quercinitol;scyllo-Cyclohexanehexol |
| CAS: | 488-59-5 |
| Molecular Formula: | C6H12 O6 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2+,3-,4+,5-,6+ |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 350 °C |
| Flash Point: | 143.4°C |
| Boiling Point: | 291.3°Cat760mmHg |
| Density: | 2.038g/cm3 |
| Refractive index: | 0 ° (C=1, H2O) |
| Specification: | White Crystalline Solid usageEng:A cyclohexanehexol derivative used in the treatment of amyotrophic lateral sclerosis |
| Flash Point: | 143.4°C |
| Usage: | A cyclohexanehexol derivative used in the treatment of amyotrophic lateral sclerosis |
| Safety Data | |
 |
|
