| Identification | |
| Name: | Inositol |
| Synonyms: | Meat sugar;myo-Inositol;Inositol NF12;INOSITIOL;Inositol, myo-;1,2,3,4,5,6-cyclohexanehexol, (1alpha,2alpha,3alpha,4beta,5alpha,6beta);1D-myo-Inositol;Myoinosite;1L-myo-Inositol;Inositene;Nucite;myo-inositols;Mesoinosite;Inositina;L-myo-Inositol;Phaseomannitol;benzene-1,2,3,4,5,6-hexol;(1r,2R,3S,4s,5R,6S)-cyclohexane-1,2,3,4,5,6-hexol;Dambose;meso-Inositol;Mesoinositol;Inositol (VAN);D-myo-Inositol;Iso-inositol;Isoinositol;Insitolum;cyclohexane-1,2,3,4,5,6-hexol;Mesoinosit;Bios I;cis-1,2,3,5-trans-4,6-Cyclohexanehexol;Mesol;1,2,3,5/4,6-cyclohexanehexol;1,2,3,5-trans-4,6-Cyclohexanehexol, cis-;Inositol, myo- (8CI);Hexahydroxycyclohexane;1,2,3,5/4, 6-Cyclohexanehexol; |
| CAS: | 87-89-8 |
| EINECS: | 201-781-2 |
| Molecular Formula: | C6H12O6 |
| Molecular Weight: | 180.16 |
| InChI: | InChI=1/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H/t1-,2-,3-,4+,5-,6- |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Density: | 2.039 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Appearance: | white powder |
| Specification: |
?Inositol (CAS NO.87-89-8) is also named as 1,2,3,5-trans-4,6-Cyclohexanehexol, cis- ; AI3-16111 ; CCRIS 6745 ; Dambose ;?Inosital ; Inositene ; Inositina ; Inositol (VAN) ; Inositol, i- ; Inositol, meso- ; Inositol, myo- ; Insitolum ; Iso-inositol ; Isoinositol ; Meat sugar ; Mesoinosit ; Mesoinosite ; Mesoinositol ; Mesol ; Mesovit ; Myoinosite ; Myoinositol ; NSC 404118 ; NSC 8101 ; Nucite ; Phaseomannite ; Phaseomannitol ; Scyllite ; UNII-4L6452S749 ; i-Inositol ; meso-Inositol .?It is white powder.?It is almost tasteless, with a small amount of sweetness. It is soluble in water, slightly soluble in ethanol, acetic acid, ethylene glycol and glycerin, insoluble in ether, acetone and chloroform . |
| HS Code: | 29061390 |
| Storage Temperature: | Store at RT. |
| Usage: | Antidepressent. |
| Safety Data | |
 |
|
