| Identification | |
| Name: | D-Ribonic acid,2-C-methyl-, g-lactone |
| Synonyms: | Ribonicacid, 2-C-methyl-, g-lactone, D- (7CI,8CI); 2-C-Methyl-D-ribo-pentonic acid g-lactone; NSC 19768; NSC 62382; a-D-Glucosaccharinic acid g-lactone |
| CAS: | 492-30-8 |
| Molecular Formula: | C6H10 O5 |
| Molecular Weight: | 162.1406 |
| InChI: | InChI=1/C6H10O5/c1-6(10)4(8)3(2-7)11-5(6)9/h3-4,7-8,10H,2H2,1H3/t3-,4-,6-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.512 g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
2-C-Methyl-D-ribono-1,4-lactone (CAS NO.492-30-8), its Synonyms are 3,4-Dihydroxy-5-(hydroxymethyl)-3-methyloxolan-2-one ; (3R,4R,5R)-3,4-dihydroxy-5-(hydroxymethyl)-3-methyldihydrofuran-2(3H)-one ; 3,4-Dihydroxy-3-methyl-5-methylol-tetrahydrofuran-2-one . |
| Usage: | Used in synthesis of enantiomerically pure 4-substituted riboses; also for preparing saccharinic acids and lactones via Amadori rearrangement for use as synthons toward herbicidal esters and branched nucleosides. |
| Safety Data | |
 |
|
