| Identification | |
| Name: | D-Ribonic acid, g-lactone |
| Synonyms: | Ribonicacid, g-lactone, D- (8CI);(+)-Ribonolactone; D-(+)-Ribonic acid lactone; D-(+)-Ribonic acid g-lactone; D-(+)-Ribonolactone;D-Ribono-1,4-lactone; D-Ribono-g-lactone; D-Ribonolactone; D-Ribopentono-1,4-lactone; NSC 1031; Ribonicacid 1,4-lactone |
| CAS: | 5336-08-3 |
| EINECS: | 226-256-5 |
| Molecular Formula: | C5H8 O5 |
| Molecular Weight: | 148.11 |
| InChI: | InChI=1/C5H8O5/c6-1-2-3(7)4(8)5(9)10-2/h2-4,6-8H,1H2/t2?,3-,4-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 83-85 ºC |
| Flash Point: | 162.8°C |
| Boiling Point: | 364.3°Cat760mmHg |
| Density: | 1.667g/cm3 |
| Stability: | Stable |
| Refractive index: | 18 ° (C=1, H2O) |
| Alpha: | 18 º (C=5, H2O) |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Specification: |
D(+)-Ribonic acid gamma-lactone , its cas register number is 5336-08-3. It also can be called D-Ribono-1,4-lactone ; D-Ribono-gamma-lactone ; D-Ribonolactone (VAN) ; D-Ribopentono-1,4-lactone ; Ribono-gamma-lactone ; gamma-Lactone of ribonic acid ; Ribonic acid, gamma-lactone, D- (8CI) .It is a white crystalline solid. |
| Flash Point: | 162.8°C |
| Usage: | Important chiral synthon |
| Safety Data | |
 |
|
