| Identification | |
| Name: | D-Ribonic acid,5-bromo-5-deoxy-2,3-O-(1-methylethylidene)-, g-lactone |
| Synonyms: | Furo[3,4-d]-1,3-dioxole,D-ribonic acid deriv. |
| CAS: | 94324-23-9 |
| Molecular Formula: | C8H11 Br O4 |
| Molecular Weight: | 251.07 |
| InChI: | InChI=1/C8H11BrO4/c1-8(2)12-5-4(3-9)11-7(10)6(5)13-8/h4-6H,3H2,1-2H3/t4-,5-,6-/m1/s1 |
| Molecular Structure: | ![(C8H11BrO4) Furo[3,4-d]-1,3-dioxole,D-ribonic acid deriv.](https://img1.guidechem.com/chem/e/dict/103/94324-23-9.gif) |
| Properties | |
| Melting Point: | 85-89 °C |
| Flash Point: | 160.3°C |
| Boiling Point: | 341.4°C at 760 mmHg |
| Density: | 1.519g/cm3 |
| Refractive index: | 1.49 |
| Specification: | Pale Yellow Solid usageEng:A key intermediate for the synthesis of olefinic optically active building blocks Safety Statements:24/25 24/25:Avoid contact with skin and eyes |
| Flash Point: | 160.3°C |
| Storage Temperature: | 0-6°C |
| Usage: | A key intermediate for the synthesis of olefinic optically active building blocks |
| Safety Data | |
 |
|
