| Identification |
| Name: | Methyl 2-methyl-2-propenoate, 2-propenoic acid, N-hydroxymethyl-2-propenamide polymer |
| Synonyms: | AC1O54SY;Methyl methacrylate, N-methylol acrylamide, acrylic acid polymer;Methyl 2-methyl-2-propenoate, 2-propenoic acid, N-hydroxymethyl-2-propenamide polymer;N-(hydroxymethyl)prop-2-enamide; methyl 2-methylprop-2-enoate; prop-2-enoic acid;2-Propenoic acid, 2-methyl-, methyl ester, polymer with N-(hydroxymethyl)-2-propenamide and 2-propenoic acid;49625-74-3 |
| CAS: | 49625-74-3 |
| Molecular Formula: | C12H19NO6 |
| Molecular Weight: | 273.28236 |
| InChI: | InChI=1S/C5H8O2.C4H7NO2.C3H4O2/c1-4(2)5(6)7-3;1-2-4(7)5-3-6;1-2-3(4)5/h1H2,2-3H3;2,6H,1,3H2,(H,5,7);2H,1H2,(H,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 10°C |
| Boiling Point: | 100.3°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 10°C |
| Safety Data |
| |
 |
