| Identification | |
| Name: | Sodium carbonate |
| Synonyms: | Sodium carbonate anhydrous; Sodium carbonate solution; soda ash; disodium carbonate; Sodium carbonate-12C, 13C-depleted; ASH; calcined soda; Carbonic acid disodium salt; Soda; Sodium carbonate,high-purity; Sodium carbonate,dense; SODA ASH LIGHT |
| CAS: | 497-19-8 |
| EINECS: | 207-838-8 |
| Molecular Formula: | Na2CO3 |
| Molecular Weight: | 105.99 |
| InChI: | InChI=1/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3082 9/PG 3 |
| Density: | 2.53 |
| Stability: | Stable. Incompatible with powdered alkaline earth metals, aluminium, organic nitro compounds, fluorine, alkali metals, nonmetallic oxides, concentrated sulfuric acid, oxides of phosphorus. |
| Refractive index: | 1.535 |
| Appearance: | white odourless powder |
| Specification: |
? Sodium carbonate , with CAS number of 497-19-8, can be called Bisodium carbonate ; Carbonic acid disodium salt ; Carbonic acid, disodium salt ; carbonic acid, sodium salt (1:2) ; Disodium carbonate ; Natrium Carbonicum Calcinatum ; Natrium Carbonicum Siccatum .?Sodium carbonate (CAS NO.497-19-8) is a sodium salt of carbonic acid. It most commonly occurs as a crystalline heptahydrate and is domestically well known for its everyday use as a water softener.? Sodium carbonate (CAS NO.497-19-8) is used in the manufacture of glass, glass is produced, when combined with sand (SiO2) and calcium carbonate (CaCO3) and heated to very high temperatures, then cooled very rapidly. It is also used as a relatively strong base in various settings. In chemistry, it is often used as an electrolyte. In domestic use, it is used as a water softener during laundry. |
| Packinggroup: | Z01 |
| HS Code: | 28362000 |
| Sensitive: | Hygroscopic |
| Color: | White powder Grayish-white powder or lumps containing up to 99% sodium carbonate. |
| Usage: | Baking powder, ph adjustment, fungicide, microbiocide, herbicide. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
