| Identification | |
| Name: | Nipecotic acid |
| Synonyms: | 3-Piperidinecarboxylicacid;Nipecoticacid (6CI,7CI,8CI);3-Carboxypiperidine;DL-Nipecotic acid;Hexahydronicotinic acid;3-Piperidinecarboxylic Acid;Piperidine-3-carboxylic acid;H-DL-Nip-OH; |
| CAS: | 498-95-3 |
| EINECS: | 207-873-9 |
| Molecular Formula: | C6H11NO2 |
| Molecular Weight: | 129.16 |
| InChI: | InChI=1/C6H11NO2/c8-6(9)5-2-1-3-7-4-5/h5,7H,1-4H2,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.125 g/cm3 |
| Refractive index: | 1.478 |
| Appearance: | off-white to pale yellow-beige powder |
| Specification: |
?Nipecotic acid,its cas register number is 498-95-3. It also can be called?(3R)-(-)-piperidin-3-ylcarboxylic acid;(+/-)-3-piperidine carboxylic acid ; 3-Piperidinecarboxylic acid ; L-nipecotic acid ; Dl-nipecotic acid ; Dl-3-piperidinecarboxylic acid ; (-)-D-nipecotic acid and so on. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
