| Identification | |
| Name: | Lactic acid |
| Synonyms: | DL-Milchsaeure;Propanoic acid, 2-hydroxy-;2-Hydroxy-2-methylacetic acid;Aethylidenmilchsaeure;Purac FCC 88;2-Hydroxypropionic acid;Tonsillosan;Racemic lactic acid;Milk acid;alpha-Hydroxypropanoic acid;FEMA No. 2611;Chem-Cast;Lactovagan;Lactate (TN);2-hydroxypropanoic acid;(RS)-2-Hydroxypropionsaeure;Propanoic acid, 2-hydroxy- (9CI);(+-)-2-Hydroxypropanoic acid;Fermentationlactic acid Propanoic acid,2-hydroxy-;SY-83;Ordinary lactic acid;Biolac;Acidum lacticum;Lactic acid (7CI,8CI);alpha-hydroxypropionic acid;Milchsaeure;1-Hydroxyethanecarboxylic acid; |
| CAS: | 50-21-5 |
| EINECS: | 200-018-0 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.09 |
| InChI: | InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 |
| Melting Point: | 18 oC |
| Density: | 1.276 g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.4252-1.4272 |
| Alpha: | -0.05 o (C= NEAT 25 oC) |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE |
| Appearance: | colourless to yellow liquid |
| Specification: |
? ?Lactic acid ,?its cas register number is 50-21-5. It also can be called?(RS)-2-Hydroxypropionsaeure ; 1-Hydroxyethanecarboxylic acid ; 2-Hydroxypropanoic acid ; Acidum lacticum ; Aethylidenmilchsaeure ; DL-Lactic acid ; DL-Milchsaeure ; Ethylidenelactic acid ; Kyselina 2-hydroxypropanova ; Kyselina mlecna ; Lactate?; Lactovagan ; Milchsaeure ; |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
C: Corrosive
|
 |
|
