| Identification | |
| Name: | DL-Lactic acid |
| Synonyms: | 2-Hydroxypropanoic acid; 2-Hydroxypropionic acid; Lactic acid; Lactic acid, dl-; Propanoic acid, 2-hydroxy-; (RS)-2-Hydroxypropionsaeure; 1-Hydroxyethanecarboxylic acid; AI3-03130; Acidum lacticum; BRN 5238667; CCRIS 2951; Lactovagan; Tonsillosan; alpha-Hydroxypropionic acid |
| CAS: | 598-82-3;50-21-5 |
| EINECS: | 200-018-0;209-954-4 |
| Molecular Formula: | C3H6O3 |
| Molecular Weight: | 90.08 |
| InChI: | InChI=1/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 |
| Density: | 1.209 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | SOLUBLE |
| Solubility: | Miscible with alcohol, glycerol, and furfural Soluble in alcohol and furfurol; slightly soluble in ether; insoluble in chloroform, petroleum ether, carbon disulfide. Miscible in alcohol-ether solution. In water, miscible |
| Appearance: | colourless to yellow liquid |
| Packinggroup: | III |
| HS Code: | 29181100 |
| Color: | Crystals Yellow to colorless crystals or syrupy 50% liquid |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
