| Identification | |
| Name: | 2,5-Cyclohexadien-1-one,4-[(4-hydroxyphenyl)imino]- |
| Synonyms: | Indophenol(6CI,7CI,8CI); Benzenoneindophenol; Phenolindophenol |
| CAS: | 500-85-6 |
| EINECS: | 207-913-5 |
| Molecular Formula: | C12H9 N O2 |
| Molecular Weight: | 199.21 |
| InChI: | InChI=1/C12H9NO2/c14-11-5-1-9(2-6-11)13-10-3-7-12(15)8-4-10/h1-8,14H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | 171.5°C |
| Boiling Point: | 360°Cat760mmHg |
| Density: | 1.18g/cm3 |
| Refractive index: | 1.6 |
| Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 171.5°C |
| Safety Data | |
 |
|
