| Identification | |
| Name: | 1H-Indazole-3-carboxylicacid, 1-[(2,4-dichlorophenyl)methyl]- |
| Synonyms: | 1-(2,4-Dichlorobenzyl)-1H-indazole-3-carboxylicacid;AF 1890;DICA;Diclondazolic acid; |
| CAS: | 50264-69-2 |
| EINECS: | 256-510-0 |
| Molecular Formula: | C15H10Cl2N2O2 |
| Molecular Weight: | 321.1581 |
| InChI: | InChI=1S/C15H10Cl2N2O2/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21/h1-7H,8H2,(H,20,21) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.47 g/cm3 |
| Refractive index: | 1.678 |
| Water Solubility: | soluble in methanol or acetic acid |
| Solubility: | soluble in methanol or acetic acid |
| Appearance: | white to light yellow crystal |
| Specification: | Safety Statements:53-22-36/37/39-45 53:Avoid exposure - obtain special instruction before use 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Biological Activity: | Anticancer and antispermatogenic agent in vitro and in vivo . Inhibits cellular energy metabolism in some cells via inhibition of mitochondrial hexokinase. Also blocks CFTR Cl - channels in vitro . |
| Storage Temperature: | Keep tightly closed. Store in a cool dry place. |
| Usage: | Anti-neoplastic medication. |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
