| Identification | |
| Name: | 1H-Indazole-3-carboxylicacid, 1-methyl- |
| Synonyms: | 1H -Methylindazole-3-carboxylic acid;1-Methylindazole-3-carboxylic acid (Granisetron int.);1-Methyl-1H-indazole-3-carboxylicacid;3-Carboxy-1-methylindazole; |
| CAS: | 50890-83-0 |
| Molecular Formula: | C9H8N2O2 |
| Molecular Weight: | 176.17202 |
| InChI: | InChI=1S/C9H8N2O2/c1-11-7-5-3-2-4-6(7)8(10-11)9(12)13/h2-5H,1H3,(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 185.8 oC |
| Boiling Point: | 383.7oC at 760 mmHg |
| Density: | 1.35 g/cm3 |
| Refractive index: | 1.653 |
| Water Solubility: | SOLVENT |
| Solubility: | SOLVENT |
| Appearance: | off-white to yellowish powder |
| Specification: | Off White Solid usageEng:Granisetron Impurity D. Safety Statements:26-36/37/39-22 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust |
| Flash Point: | 185.8 oC |
| Storage Temperature: | Refrigerator |
| Usage: | Granisetron Impurity D. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
