| Identification |
| Name: | Benzenemethanamine,3-methoxy- |
| Synonyms: | Benzylamine,m-methoxy- (7CI,8CI);(3-Methoxyphenyl)methanamine;3-Methoxybenzenemethanamine;NSC 162042;[[3-(Methyloxy)phenyl]methyl]amine;m-Methoxybenzylamine;1-(3-Methoxyphenyl)methanamine; |
| CAS: | 5071-96-5 |
| EINECS: | 225-779-6 |
| Molecular Formula: | C8H11NO |
| Molecular Weight: | 137.18 |
| InChI: | InChI=1/C8H11NO/c1-10-8-4-2-3-7(5-8)6-9/h2-5H,6,9H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Density: | 1.072 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.547-1.549 |
| Solubility: | Very soluble |
| Appearance: | Colorless to light yellow liqui |
| Packinggroup: | III |
| Storage Temperature: | Keep container closed when not in use. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Keep containers tightly closed. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
