Identification |
Name: | 2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with methyl 2-methyl-2-propenoate and methyl 2-propenoate |
Synonyms: | AC1O552S;Methyl methacrylate, methyl acrylate, dimethylaminoethyl methacrylate polymer;2-dimethylaminoethyl 2-methylprop-2-enoate; methyl 2-methylprop-2-enoate; methyl prop-2-enoate;2-Propenoic acid, 2-methyl-, 2-(dimethylamino)ethyl ester, polymer with methyl 2-methyl-2-propenoate and methyl 2-propenoate;50862-66-3 |
CAS: | 50862-66-3 |
Molecular Formula: | C17H29NO6 |
Molecular Weight: | 343.41526 |
InChI: | InChI=1S/C8H15NO2.C5H8O2.C4H6O2/c1-7(2)8(10)11-6-5-9(3)4;1-4(2)5(6)7-3;1-3-4(5)6-2/h1,5-6H2,2-4H3;1H2,2-3H3;3H,1H2,2H3 |
Molecular Structure: |
|
Properties |
Safety Data |
|
|