| Identification | |
| Name: | Phenol, 2-amino-,hydrochloride (1:1) |
| Synonyms: | Phenol,2-amino-, hydrochloride (9CI); Phenol, o-amino-, hydrochloride (8CI);2-Aminophenol hydrochloride; o-Aminophenol hydrochloride; o-Hydroxyanilinehydrochloride |
| CAS: | 51-19-4 |
| EINECS: | 202-431-1 |
| Molecular Formula: | C6H7 N O . Cl H |
| Molecular Weight: | 109.1259 |
| InChI: | InChI=1/C6H7NO/c7-5-3-1-2-4-6(5)8/h1-4,8H,7H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.21 g/cm3 |
| Refractive index: | 1.637 |
| Solubility: | 1 g dissolves in 50 ml cold water, 23 ml alc Slightly soluble in benzene, toluene, chloroform, and cold water; soluble in diethyl ether, ethanol, and hot water, very soluble in acetonitrile, ethyl acetate, acetone, dimethyl sulfoxide In water, 20,000 mg/l at 20 deg C |
| Color: | Crystals, rapidly becoming brown White orthorhombic bipyramidal needles from benzene or water COLORLESS RHOMBIC NEEDLES OR PLATES |
| Safety Data | |
 |
|
