Identification |
Name: | L-Tyrosine,O-(4-hydroxy-3,5-diiodophenyl)-3,5-diiodo- |
Synonyms: | Thyroxine,L- (8CI);(-)-Thyroxine;3,3',5,5'-Tetraiodo-L-thyronine;Henning;L-T4;L-Thyroxin;Levothyroxine;NSC 36397;T4;T4 (hormone);THX;Tetraiodothyronine;Thyrax;Thyreoideum;Thyroxin;Thyroxinal;Thyroxine; |
CAS: | 51-48-9 |
EINECS: | 200-101-1 |
Molecular Formula: | C15H11I4NO4 |
Molecular Weight: | 776.87 |
InChI: | InChI=1/C15H11I4NO4/c16-8-4-7(5-9(17)13(8)21)24-14-10(18)1-6(2-11(14)19)3-12(20)15(22)23/h1-2,4-5,12,21H,3,20H2,(H,22,23)/t12-/m0/s1 |
Molecular Structure: |
 |
Properties |
Density: | 2.635g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.795 |
Alpha: | -5 o (1N NAOH:ETOH 1:2) |
Water Solubility: | insoluble |
Solubility: | Water Solubility : insoluble |
Appearance: | Beige powder. |
Specification: | Crystalline Solid usageEng:One of the thyroid hormones involved in the maintenance of metabolic homeostasis. Synthesized and stored as amino acid residues of thyroglobulin, the major protein component of the thyroid follicular colloid. Synthesis and secretion are regulated by the p Safety Statements:22-24/25-36 22:Do not breathe dust 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing |
Color: | CRYSTALS NEEDLES |
Usage: | One of the thyroid hormones involved in the maintenance of metabolic homeostasis. Synthesized and stored as amino acid residues of thyroglobulin, the major protein component of the thyroid follicular colloid. Synthesis and secretion are regulated by |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |