| Identification | ||
| Name: | 1,3-Benzenediamine, 4-nitro- | |
| Synonyms: | m-Phenylenediamine,4-nitro- (6CI,7CI,8CI);1,3-Diamino-4-nitrobenzene;2,4-Diaminonitrobenzene;4-Nitro-1,3-benzenediamine;C.I. 76030;4-Nitro-m-phenylenediamine; | |
| CAS: | 5131-58-8 | |
| EINECS: | 225-876-3 | |
| Molecular Formula: | C6H7N3O2 | |
| Molecular Weight: | 153.14 | |
| InChI: | InChI=1/C6H7N3O2/c7-4-1-2-6(9(10)11)5(8)3-4/h1-3H,7-8H2 | |
| Molecular Structure: |  |
|
| Properties | ||
| Flash Point: | 430.2 ºC at 760 mmHg | |
| Boiling Point: | 430.2 ºC at 760 mmHg | |
| Density: | 1.446 g/cm3 | |
| Stability: | No data. | |
| Refractive index: | 1.708 | |
| Water Solubility: | <0.1 g/100 mL at 20.5 ºC | |
| Solubility: | In water, 2.49X10+4 mg/L at 25 deg C (est) | |
| Appearance: | Yellow crystal powder | |
| Specification: |
4-Nitro-m-phenylenediamine (CAS NO.5131-58-8), its Synonyms are 1,3-Benzenediamine, 4-nitro- ; 4-Nitro-1,3-benzenediamine ; 4-Nitro-1,3-diaminobenzene ; 1,3-Diamino-4-nitrobenzene ; 2,4-Diaminonitrobenzene ; m-Phenylenediamine, 4-nitro- . It is yellow crystal powder. | |
| Report: |
Reported in EPA TSCA Inventory. | |
| Flash Point: | 430.2 ºC at 760 mmHg | |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. | |
| Color: | Orange prisms from water | |
| Safety Data | ||
 |
||
