| Identification | |
| Name: | 7-bromoindole |
| Synonyms: | 7-Bromo-1H-indole |
| CAS: | 51417-51-7 |
| Molecular Formula: | C8H6BrN |
| Molecular Weight: | 196.04 |
| InChI: | InChI=1/C8H6BrN/c9-7-3-1-2-6-4-5-10-8(6)7/h1-5,10H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.66g/cm3 |
| Refractive index: | 1.711 |
| Appearance: | Beige-yellowish or brownish crystalline powder |
| Specification: | Beige-yellowish or brownish crystalline powder Safety Statements:26-36-36/37/39-22-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 22:Do not breathe dust 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| HS Code: | 29339990 |
| Sensitive: | Light Sensitive |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
