| Identification | |
| Name: | 2-(Ethylamino)propiophenone hydrochloride |
| Synonyms: | 2-(Ethylamino)-1-phenyl-1-propanone hydrochloride;Mephedrone(2-methylamino-1-p-tolypropan-1-one);RMI 8201A; |
| CAS: | 51553-17-4 |
| Molecular Formula: | C11H16ClNO |
| Molecular Weight: | 213.70 |
| InChI: | InChI=1/C11H15NO.ClH/c1-3-12-9(2)11(13)10-7-5-4-6-8-10;/h4-9,12H,3H2,1-2H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 195-198 oC |
| Flash Point: | 105 oC |
| Boiling Point: | 272.3 oC at 760 mmHg |
| Appearance: | white solid |
| Specification: | White Solid usageEng:Ethcathinone is a metabolite of Diethylpropion. It is a cathinone derivative that produces amphetamine-like stimulus effects Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 105 oC |
| Storage Temperature: | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| Usage: |
2-(Ethylamino)-1-phenylpropan-1-one hydrochloride (1:1) (CAS NO.51553-17-4) is used as a metabolite of Diethylpropion. |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
