Identification |
Name: | Methylmalonic acid |
Synonyms: | Methylmalonicacid,98%; Methyl (Ethoxy Methylene) Cyanoacetate |
CAS: | 516-05-2 |
EINECS: | 208-219-5 |
Molecular Formula: | C4H6O4 |
Molecular Weight: | 118.09 |
InChI: | InChI=1/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8) |
Molecular Structure: |
 |
Properties |
Transport: | OTH |
Flash Point: | 170.2°C |
Boiling Point: | 334.4°Cat760mmHg |
Density: | 1.45 |
Stability: | Stable under normal temperatures and pressures. |
Water Solubility: | soluble |
Solubility: | Very soluble |
Appearance: | white crystals |
Flash Point: | 170.2°C |
Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
Usage: | Increased methylmalonic acid levels in the blood may indicate a vitamin b12 deficiency. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
 |