| Identification |
| Name: | Methylmalonic acid |
| Synonyms: | Methylmalonicacid,98%; Methyl (Ethoxy Methylene) Cyanoacetate |
| CAS: | 516-05-2 |
| EINECS: | 208-219-5 |
| Molecular Formula: | C4H6O4 |
| Molecular Weight: | 118.09 |
| InChI: | InChI=1/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8) |
| Molecular Structure: |
 |
| Properties |
| Transport: | OTH |
| Flash Point: | 170.2°C |
| Boiling Point: | 334.4°Cat760mmHg |
| Density: | 1.45 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | soluble |
| Solubility: | Very soluble |
| Appearance: | white crystals |
| Flash Point: | 170.2°C |
| Storage Temperature: | Store in a cool, dry place. Keep container closed when not in use. |
| Usage: | Increased methylmalonic acid levels in the blood may indicate a vitamin b12 deficiency. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
