| Identification | |
| Name: | Estra-1,3,5,7,9-pentaen-17-one,3-hydroxy- |
| Synonyms: | Equilenin(6CI); (+)-Equilenin; 3-Hydroxyestra-1,3,5(10),6,8-pentaen-17-one; E 400;Equilenine; NSC 9901; d-Equilenin |
| CAS: | 517-09-9 |
| EINECS: | 208-230-5 |
| Molecular Formula: | C18H18 O2 |
| Molecular Weight: | 266.36 |
| InChI: | InChI=1/C18H18O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h2-5,10,16,19H,6-9H2,1H3/t16-,18-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1648 3/PG 2 |
| Flash Point: | 200.9°C |
| Boiling Point: | 472.6°Cat760mmHg |
| Density: | 1.242g/cm3 |
| Refractive index: | 1.662 |
| Specification: |
Equilenin (CAS NO.517-09-9) is also called 3-Hydroxyestra-1,3,5(10),6,8-pentaen-17-one ; 4-08-00-01420 (Beilstein Handbook Reference) ; BRN 2335367 ; CCRIS 9075 ; Equilenina [Spanish] ; Equilenine ; Estra-1,3,5(10),6,8-pentaen-17-one, 3-hydroxy- ; Isoequilenin ; NSC 9901 ; d-Equilenin . |
| Flash Point: | 200.9°C |
| Storage Temperature: | 2-8°C |
| Usage: | Estrogenic steroidal hormone isolated from urine of pregnant mares. Occurs naturally in the d-form. Not found in human urine. Component of conjugated estrogenic hormones. Estrogen. |
| Safety Data | |
 |
|
