| Identification | |
| Name: | 4-Aminoindole |
| Synonyms: | 1H-indol-4-amine; |
| CAS: | 5192-23-4 |
| EINECS: | -0 |
| Molecular Formula: | C8H8N2 |
| Molecular Weight: | 132.16 |
| InChI: | InChI=1/C8H8N2/c9-7-2-1-3-8-6(7)4-5-10-8/h1-5,10H,9H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 354 oC at 760 mmHg |
| Boiling Point: | 354 oC at 760 mmHg |
| Density: | 1.268g/cm3 |
| Refractive index: | 1.757 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | greenish-grey to tan powder |
| Specification: |
?4-Aminoindole (CAS NO.5192-23-4), its Synonyms are 4-Amino Indole ; 4-Amino-1H-indole ; 4-Indolamine ; 5-methoxyl indole-carboxaldehyde ; 4-Cyanoindole . It is greenish-grey to tan powder. |
| HS Code: | 29339990 |
| Flash Point: | 354 oC at 760 mmHg |
| Sensitive: | Air Sensitive |
| Usage: | Reactant for preparation of:• ;Inhibitors of bacterial thymidylate synthase1• ;Mimetics of non-alkaloid toxin lignan anticancer and antiviral agent Podophyllotoxin (PPT)2• ;Inhibitors of Gli1-mediated transcription in the Hedgehog pathway3• ;Protein kinase C θ (PKCθ) inhibitors4• ;Indolic non-peptidic HIV protease inhibitors5• ;Transient receptor potential cation channel subfamily V member 1 (TRPV1) antagonists6• ;Cyclooxygenase-2 (COX-2) and lipoxygenase (LOX) inhibitors7• ;11β-hydroxysteroid dehydrogenase 1 (11β-HSD1) inhibi |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
