| Identification | |
| Name: | 5-AMINOINDOLE HYDROCHLORIDE |
| Synonyms: | 5-AMINOINDOLE HYDROCHLORIDE;5-AMINOINDOLE MONOHYDROCHLORIDE;TIMTEC-BB SBB003873;5-AminoindoleHCl;5-indolamine hydrochloride;1H-Indole-5-amine/hydrochloric acid,(1:x) |
| CAS: | 65795-92-8 |
| Molecular Formula: | C8H9ClN2 |
| Molecular Weight: | 168.62 |
| InChI: | InChI=1/C8H8N2.ClH/c9-7-1-2-8-6(5-7)3-4-10-8;/h1-5,10H,9H2;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 255-257 °C(lit.) |
| Flash Point: | 179°C |
| Boiling Point: | 372.4°C at 760 mmHg |
| Specification: | Safety Statements:7-22-36/37/39-45 7:Keep container tightly closed 22:Do not breathe dust 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 179°C |
| Safety Data | |
 |
|
