| Identification |
| Name: | 5-Methoxytryptamine hydrochloride |
| Synonyms: | 1H-Indole-3-ethanamine,5-methoxy-, monohydrochloride (9CI);Indole, 3-(2-aminoethyl)-5-methoxy-,monohydrochloride (8CI);5-Methoxytryptamine chloride;5-Methoxytryptaminemonohydrochloride;Mexamin;Mexamine; |
| CAS: | 66-83-1 |
| EINECS: | 200-637-6 |
| Molecular Formula: | C11H15ClN2O |
| Molecular Weight: | 226.7 |
| InChI: | InChI=1/C11H14N2O.ClH/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11;/h2-3,6-7,13H,4-5,12H2,1H3;1H |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.171 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Appearance: | white to beige crystalline powder |
| Storage Temperature: | 2-8°C |
| Sensitive: | Hygroscopic |
| Color: | white |
| Usage: | A metabolite of Melatonin |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
