| Identification |
| Name: | 5-Methoxytryptamine |
| Synonyms: | Indole,3-(2-aminoethyl)-5-methoxy- (6CI,8CI);2-(5-Methoxyindol-3-yl)ethylamine;2-[5-(Methyloxy)-1H-indol-3-yl]ethanamine;3-(2-Aminoethyl)-5-methoxyindole;5-MOT;5-Methoxy-1H-indole-3-ethanamine;Deacetylmelatonin;Methoxytryptamine;NSC 56422;[2-(5-Methoxy-1H-indol-3-yl)ethyl]amine; |
| CAS: | 608-07-1 |
| EINECS: | 210-153-7 |
| Molecular Formula: | C11H14N2O |
| Molecular Weight: | 190.24 |
| InChI: | InChI=1/C11H14N2O/c1-14-9-2-3-11-10(6-9)8(4-5-12)7-13-11/h2-3,6-7,13H,4-5,12H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 184 |
| Boiling Point: | 380 |
| Stability: | Stable at normal temperatures and pressures. |
| Solubility: | Very soluble |
| Appearance: | White to tan crystalline powder |
| Flash Point: | 184 |
| Storage Temperature: | 2-8°C |
| Color: | white |
| Usage: | Serotonin derivative proposed as potentiator for hypnotics and sedatives. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
