| Identification | |
| Name: | 2-Hexanol, (2S)- |
| Synonyms: | 2-Hexanol,(S)-; (+)-2-Hexanol; (2S)-Hexan-2-ol; (S)-(+)-2-Hexanol; (S)-2-Hexanol |
| CAS: | 52019-78-0 |
| EINECS: | 210-971-4 |
| Molecular Formula: | C6H14 O |
| Molecular Weight: | 102.17 |
| InChI: | InChI=1/C6H14O/c1-3-4-5-6(2)7/h6-7H,3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1992 |
| Density: | 0.818 |
| Refractive index: | 1.413-1.415 |
| Alpha: | 11 º (C=NEAT) |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble in Water |
| Appearance: | COLORLESS LIQUID |
| Specification: |
(S)-(+)-2-hexanol (52019-78-0) is chiral compound with appearance of colorless to light yellow liquid. (S)-(+)-2-hexanol (52019-78-0) is also known as (S)-2-hexanol ; (S)-(+)-hydroxyhexane ; (S)-(+)-hexanol ; (S)-1,3-butanediol ee 99+% ; (S)-hexan-2-ol ; S-(+)-2-hexanol ,98% . It is incompatible with other materials such as strong oxidizing agents, strong oxidizing agents, acids and acid chlorides. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
