| Identification |
| Name: | 2-(Tetrapropenyl)succinic acid, monoester with propane-1,2-diol |
| Synonyms: | 2-(tetrapropenyl)succinic acid, monoester with propane-1,2-diol;Butanedioic acid, (tetrapropenyl)-, monoester with 1,2-propanediol;2-(Tetrapropenyl)bersteinsure, MonoEster mit Propan-1,2-diol;Tetrapropenylsuccinic acid, 1,2-propanediol half eser |
| CAS: | 52305-09-6 |
| EINECS: | 257-836-6 |
| Molecular Formula: | C19H34O5 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C19H36O5/c1-3-4-5-6-7-8-9-10-11-12-13-17(19(22)23)14-18(21)24-16(2)15-20/h16-17,20H,3-15H2,1-2H3,(H,22,23) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 158.7°C |
| Boiling Point: | 477.9°Cat760mmHg |
| Density: | 1.027g/cm3 |
| Refractive index: | 1.472 |
| Flash Point: | 158.7°C |
| Safety Data |
| |
 |
