Identification |
Name: | palmitic acid, monoester with propane-1,2-diol |
Synonyms: | Palmitic acid, monoester with propane-1,2-diol;2-hydroxypropyl hexadecanoate |
CAS: | 29013-28-3 |
EINECS: | 249-369-1 |
Molecular Formula: | C19H38O3 |
Molecular Weight: | 314.5032 |
InChI: | InChI=1/C19H38O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19(21)22-17-18(2)20/h18,20H,3-17H2,1-2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 158.2°C |
Boiling Point: | 420.5°C at 760 mmHg |
Density: | 0.915g/cm3 |
Refractive index: | 1.455 |
Flash Point: | 158.2°C |
Safety Data |
|
 |