| Identification |
| Name: | butyric acid, monoester with propane-1,2,3-triol |
| Synonyms: | 1-Butyrylglycerol;AI3-28578;Butanoic acid, monoester with 1,2,3-propanetriol;Butyric acid, monoester with propane-1,2,3-triol;2,3-dihydroxypropyl butanoate |
| CAS: | 26999-06-4 |
| EINECS: | 248-160-2 |
| Molecular Formula: | C7H14O4 |
| Molecular Weight: | 162.1837 |
| InChI: | InChI=1/C7H14O4/c1-2-3-7(10)11-5-6(9)4-8/h6,8-9H,2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 111.3°C |
| Boiling Point: | 280.5°C at 760 mmHg |
| Density: | 1.134g/cm3 |
| Refractive index: | 1.461 |
| Flash Point: | 111.3°C |
| Safety Data |
| |
 |
