| Identification | |
| Name: | Cyclopropylacetic acid |
| Synonyms: | 2-Cyclopropaneaceticacid;2-Cyclopropylacetic acid; |
| CAS: | 5239-82-7 |
| EINECS: | -0 |
| Molecular Formula: | C5H8O2 |
| Molecular Weight: | 100.12 |
| InChI: | InChI=1/C5H8O2/c6-5(7)3-4-1-2-4/h4H,1-3H2,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Flash Point: | 93.8°C |
| Boiling Point: | 191.7°Cat760mmHg |
| Density: | 1.076 |
| Refractive index: | 1.4350 |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Packinggroup: | II |
| HS Code: | 29162000 |
| Flash Point: | 93.8°C |
| Safety Data | |
 |
|
