| Identification | |
| Name: | 1,2-Naphthalenedione |
| Synonyms: | 1,2-Naphthoquinone(8CI); NSC 9831; SID 8139964; o-Naphthoquinone; b-Naphthoquinone |
| CAS: | 524-42-5 |
| EINECS: | 208-360-2 |
| Molecular Formula: | C10H6 O2 |
| Molecular Weight: | 158.15 |
| InChI: | InChI=1/C10H6O2/c11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-6H |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Melting Point: | 141 - 145 C (Decomposes) |
| Density: | 1.29g/cm3 |
| Refractive index: | 1.617 |
| Water Solubility: | slightly soluble (soluble in organic solvents) |
| Solubility: | slightly soluble (soluble in organic solvents) |
| Appearance: | dark brown powder |
| Specification: |
1,2-Naphthoquinone (CAS No.524-42-5) is a polycyclic aromatic ketone. It is a reactive metabolite of naphthalene. This compound is a quinone found in diesel exhaust particles. The accumulation of this toxic metabolite in rats from doses of naphthalene has been shown to cause eye damage, including the formation of cataracts. |
| Report: |
Reported in EPA TSCA Inventory. |
| Color: | Golden yellow needles Red needles from ether |
| Safety Data | |
| Hazard Symbols | |
 |
|
