| Identification | |
| Name: | Propane,2,2'-oxybis[1-chloro- |
| Synonyms: | Ether,bis(2-chloro-1-methylethyl) (6CI,7CI,8CI); 2,2'-Dichlorodiisopropyl ether;2,2'-Oxybis(1-chloropropane); Bis(1-chloro-2-propyl) ether;Bis(2-chloro-1-methylethyl) ether; DCIP; DCIP (nematocide); NSC 2849; b,b'-Dichlorodiisopropyl ether |
| CAS: | 52438-91-2 |
| Molecular Formula: | C6H12 Cl2 O |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C6H12Cl2O/c1-5(3-7)9-6(2)4-8/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -96.8 TO -101.8 DEG C |
| Flash Point: | 36.4°C |
| Boiling Point: | 187°Cat760mmHg |
| Density: | 1.086g/cm3 |
| Solubility: | MISCIBLE IN ORGANIC SOLVENTS MISCIBLE IN ETHYL ALCOHOL, ETHYL ETHER, ACETONE Water solubility of 1700 ppm at 20 deg C. |
| Flash Point: | 36.4°C |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
