| Identification |
| Name: | Propane,1,1'-oxybis[2-methyl- |
| Synonyms: | Isobutylether (6CI,7CI,8CI); Di-2-butyl ether; Diisobutyl ether |
| CAS: | 628-55-7 |
| EINECS: | 211-045-2 |
| Molecular Formula: | C8H18 O |
| Molecular Weight: | 130.22792 |
| InChI: | InChI=1S/C8H18O/c1-7(2)5-9-6-8(3)4/h7-8H,5-6H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 3271 |
| Flash Point: | 8°C |
| Boiling Point: | 122°C |
| Density: | 0,75 g/cm3 |
| Stability: | Flammable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.401 |
| Water Solubility: | Stability Flammable. Incompatible with strong oxidizing agents.Toxicology May be harmful or act as an irritant - toxicology notfully investigated. Risk phrases (The mea |
| Solubility: | |
| Packinggroup: | III |
| Flash Point: | 8°C |
| Safety Data |
| |
 |
