| Identification |
| Name: | Quinoline, 6-methoxy- |
| Synonyms: | Methyl 6-quinolyl ether;NSC 1954; |
| CAS: | 5263-87-6 |
| EINECS: | 226-077-2 |
| Molecular Formula: | C10H9NO |
| Molecular Weight: | 159.19 |
| InChI: | InChI=1/C10H9NO/c1-12-9-4-5-10-8(7-9)3-2-6-11-10/h2-7H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.152 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.617-1.624 |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Thin and yellow and transparent liquid |
| HS Code: | 29334990 |
| Storage Temperature: | 2-8°C |
| Sensitive: | Light Sensitive |
| Usage: | A useful sythetic intermediate |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
