| Identification | |
| Name: | aminodiphenylmethane hydrochloride |
| Synonyms: | benzhydrylammonium chloride; Benzhydrylamine hydrochloride |
| CAS: | 5267-34-5 |
| EINECS: | 226-084-0 |
| Molecular Formula: | C13H13N?HCl;C13H14ClN |
| Molecular Weight: | 219.70996 |
| InChI: | InChI=1S/C13H13N.ClH/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H,14H2;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Flash Point: | 141.8°C |
| Boiling Point: | 301.1°Cat760mmHg |
| Density: | 1.057g/cm3 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystalline powder |
| Specification: | white to off-white crystalline powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 141.8°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
