Identification |
Name: | Phenol,2-amino-4,6-dichloro- |
Synonyms: | 2,4-Dichloro-6-aminophenol;2-Amino-4,6-dichlorophenol; 4,6-Dichloro-2-aminophenol;4,6-Dichloro-o-aminophenol; 6-Amino-2,4-dichlorophenol; NSC 658464 |
CAS: | 527-62-8 |
EINECS: | 208-421-3 |
Molecular Formula: | C6H5 Cl2 N O |
Molecular Weight: | 178.02 |
InChI: | InChI=1/C6H5Cl2NO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H,9H2 |
Molecular Structure: |
 |
Properties |
Melting Point: | 97 ºC |
Density: | 1.56 g/cm3 |
Refractive index: | 1.661 |
Appearance: | light yellow or white solid |
Specification: |
2-Amino-4,6-dichlorophenol (CAS.527-62-8) also can be called 2,4-Dichloro-6-aminophenol and; Phenol, 2-amino-4,6-dichloro- . It is probably combustible, and may react with strong oxidizers and mineral acids or bases .
|
Safety Data |
|
 |