| Identification | |
| Name: | Benzene,1-methyl-2-(1-methylethyl)- |
| Synonyms: | o-Cymene(8CI); 1-Isopropyl-2-methylbenzene; 1-Methyl-2-(1-methylethyl)benzene;1-Methyl-2-isopropylbenzene; 2-Isopropyltoluene; NSC 73976; o-Cymol;o-Isopropyltoluene |
| CAS: | 527-84-4 |
| EINECS: | 208-426-0 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.24 |
| InChI: | InChI=1/C10H14/c1-8(2)10-7-5-4-6-9(10)3/h4-8H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2046 3 |
| Refractive index: | n20/D 1.499(lit.) |
| Solubility: | Miscible with ethanol, ether, and acetone In water, 23.3 mg/l @ 25 deg C. |
| Specification: |
Downstream products of 2-Isopropyltoluene (CAS NO.527-84-4) is Cresol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Safety Data | |
 |
|
