| Identification | ||
| Name: | o-Tolunitrile | |
| Synonyms: | 2-Methylbenzenecarbonitrile; CNT; o-Tolunitrile = 2-Cyanotoluene; ortho-tolunitrile; o-toluonitrile; 2-Methylbenzonitrile/o-Tolunitrile; o-toluenenitrile; 2-Methylbenzonitrile; 2 cyano toluene | |
| CAS: | 529-19-1 | |
| EINECS: | 208-451-7 | |
| Molecular Formula: | C8H7N | |
| Molecular Weight: | 117.15 | |
| InChI: | InChI=1/C8H7N/c1-7-4-2-3-5-8(7)6-9/h2-5H,1H3 | |
| Molecular Structure: |  |
|
| Properties | ||
| Transport: | 3276 | |
| Density: | 0.989 | |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. | |
| Refractive index: | 1.5269-1.5289 | |
| Water Solubility: | <0.1 g/100 mL at 17 ºC | |
| Solubility: | <0.1 g/100 mL at 17 oC | |
| Appearance: | Light blue clear liquid. | |
| Specification: | clear colorless to slightly yellow liquid Safety Statements:61-37-36-26 61:Avoid release to the environment. Refer to special instructions safety data sheet 37:Wear suitable gloves 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice | |
| Packinggroup: | I; II | |
| HS Code: | 29269095 | |
| Storage Temperature: | Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. | |
| Safety Data | ||
| Hazard Symbols |
Xi:Irritant
|
|
 |
||
